About N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide (PubChem CID 54582277) has the molecular formula C22H16F6N2O
and a molecular weight of 438.37 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide |
| PubChem CID | 54582277 |
| Molecular Formula | C22H16F6N2O |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide |
| SMILES | Cc1nccc(-c2ccccc2)c1C(=O)NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16F6N2O/c1-13-19(18(7-8-29-13)15-5-3-2-4-6-15)20(31)30-12-14-9-16(21(23,24)25)11-17(10-14)22(26,27)28/h2-11H,12H2,1H3,(H,30,31) |
| InChIKey | FUCPKVYRKXXLFP-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide?
The IUPAC name of N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide (CID 54582277) is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide.
What is the SMILES notation for N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide?
The canonical SMILES for N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide is Cc1nccc(-c2ccccc2)c1C(=O)NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide?
The InChIKey is FUCPKVYRKXXLFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16F6N2O/c1-13-19(18(7-8-29-13)15-5-3-2-4-6-15)20(31)30-12-14-9-16(21(23,24)25)11-17(10-14)22(26,27)28/h2-11H,12H2,1H3,(H,30,31).
What are the key properties of N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide?
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide has a molecular weight of 438.37 g/mol, XLogP of 6.02, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-4-phenylpyridine-3-carboxamide is sourced from PubChem (CID 54582277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).