C19H26O4 — CID 5458236
1,10-dihydroxy-8,8-dimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydro-4bH-phenanthrene-3,4-dione (PubChem CID 5458236) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 1,10-dihydroxy-8,8-dimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydro-4bH-phenanthrene-3,4-dione.
| Compound Name | 1,10-dihydroxy-8,8-dimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydro-4bH-phenanthrene-3,4-dione |
|---|---|
| PubChem CID | 5458236 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1,10-dihydroxy-8,8-dimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydro-4bH-phenanthrene-3,4-dione |
| SMILES | CC(C)C1=C(O)C2=C(C(=O)C1=O)C1CCCC(C)(C)C1CC2O |
| InChI | InChI=1S/C19H26O4/c1-9(2)13-16(21)15-12(20)8-11-10(6-5-7-19(11,3)4)14(15)18(23)17(13)22/h9-12,20-21H,5-8H2,1-4H3 |
| InChIKey | HWYLNJHAUPIOGB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|