About 1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine
1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine (PubChem CID 54582372) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine.
Molecular Properties
| Compound Name | 1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine |
| PubChem CID | 54582372 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine |
| SMILES | CC(N)C12CC3CC(CC1C3)C2 |
| InChI | InChI=1S/C11H19N/c1-7(12)11-5-8-2-9(6-11)4-10(11)3-8/h7-10H,2-6,12H2,1H3 |
| InChIKey | FXHSVMUTRZPZBF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine?
The IUPAC name of 1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine (CID 54582372) is 1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine.
What is the SMILES notation for 1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine?
The canonical SMILES for 1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine is CC(N)C12CC3CC(CC1C3)C2.
What is the InChIKey of 1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine?
The InChIKey is FXHSVMUTRZPZBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-7(12)11-5-8-2-9(6-11)4-10(11)3-8/h7-10H,2-6,12H2,1H3.
What are the key properties of 1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine?
1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine has a molecular weight of 165.28 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-tricyclo[3.3.1.03,7]nonanyl)ethanamine is sourced from PubChem (CID 54582372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).