C20H25NO2 — CID 54582377
2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]-N,N-dimethylethanamine (PubChem CID 54582377) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 54582377 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CC[C@@H]1CCOC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C20H25NO2/c1-21(2)15-13-19-14-16-22-20(23-19,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19H,13-16H2,1-2H3/t19-/m1/s1 |
| InChIKey | HUUYKROBFWYDKH-LJQANCHMSA-N |
| XLogP | 3.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |