C29H30FN3O3 — CID 54582399
N-[9-(2-fluorophenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]pyridine-4-carboxamide (PubChem CID 54582399) has the molecular formula C29H30FN3O3 and a molecular weight of 487.58 g/mol. Its IUPAC name is N-[9-(2-fluorophenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]pyridine-4-carboxamide.
| Compound Name | N-[9-(2-fluorophenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 54582399 |
| Molecular Formula | C29H30FN3O3 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | N-[9-(2-fluorophenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]pyridine-4-carboxamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(NC(=O)c1ccncc1)C1=C(C(=O)CC(C)(C)C1)C2c1ccccc1F |
| InChI | InChI=1S/C29H30FN3O3/c1-28(2)13-20-25(22(34)15-28)24(18-7-5-6-8-19(18)30)26-21(14-29(3,4)16-23(26)35)33(20)32-27(36)17-9-11-31-12-10-17/h5-12,24H,13-16H2,1-4H3,(H,32,36) |
| InChIKey | LVTZWGBINSZLDM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |