C10H19ClN2O2 — CID 54582542
4-chloro-1-(2-hydroxyethyl)-3,3,5,5-tetramethylpiperazin-2-one (PubChem CID 54582542) has the molecular formula C10H19ClN2O2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 4-chloro-1-(2-hydroxyethyl)-3,3,5,5-tetramethylpiperazin-2-one.
| Compound Name | 4-chloro-1-(2-hydroxyethyl)-3,3,5,5-tetramethylpiperazin-2-one |
|---|---|
| PubChem CID | 54582542 |
| Molecular Formula | C10H19ClN2O2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 4-chloro-1-(2-hydroxyethyl)-3,3,5,5-tetramethylpiperazin-2-one |
| SMILES | CC1(C)CN(CCO)C(=O)C(C)(C)N1Cl |
| InChI | InChI=1S/C10H19ClN2O2/c1-9(2)7-12(5-6-14)8(15)10(3,4)13(9)11/h14H,5-7H2,1-4H3 |
| InChIKey | SIXKMUTXKVBKPB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|