About 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid
6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid (PubChem CID 54582611) has the molecular formula C19H17N3O3S
and a molecular weight of 367.43 g/mol. Its IUPAC name is 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid |
| PubChem CID | 54582611 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid |
| SMILES | CN(CCOc1ccc2cc(C(=O)O)[nH]c2c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H17N3O3S/c1-22(19-21-14-4-2-3-5-17(14)26-19)8-9-25-13-7-6-12-10-16(18(23)24)20-15(12)11-13/h2-7,10-11,20H,8-9H2,1H3,(H,23,24) |
| InChIKey | KNPMZDMDCBMCMD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid?
The IUPAC name of 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid (CID 54582611) is 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid.
What is the SMILES notation for 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid?
The canonical SMILES for 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid is CN(CCOc1ccc2cc(C(=O)O)[nH]c2c1)c1nc2ccccc2s1.
What is the InChIKey of 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid?
The InChIKey is KNPMZDMDCBMCMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O3S/c1-22(19-21-14-4-2-3-5-17(14)26-19)8-9-25-13-7-6-12-10-16(18(23)24)20-15(12)11-13/h2-7,10-11,20H,8-9H2,1H3,(H,23,24).
What are the key properties of 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid?
6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid has a molecular weight of 367.43 g/mol, XLogP of 3.99, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1H-indole-2-carboxylic acid is sourced from PubChem (CID 54582611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).