C30H32BrF3N2O3 — CID 54582844
[(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate bromide (PubChem CID 54582844) has the molecular formula C30H32BrF3N2O3 and a molecular weight of 605.50 g/mol. Its IUPAC name is [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate bromide.
| Compound Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate bromide |
|---|---|
| PubChem CID | 54582844 |
| Molecular Formula | C30H32BrF3N2O3 |
| Molecular Weight | 605.50 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate bromide |
| SMILES | Cc1cccc(N(Cc2cc(F)c(F)cc2F)C(=O)O[C@H]2C[N+]3(CCOc4ccccc4)CCC2CC3)c1.[Br-] |
| InChI | InChI=1S/C30H32F3N2O3.BrH/c1-21-6-5-7-24(16-21)34(19-23-17-27(32)28(33)18-26(23)31)30(36)38-29-20-35(12-10-22(29)11-13-35)14-15-37-25-8-3-2-4-9-25;/h2-9,16-18,22,29H,10-15,19-20H2,1H3;1H/q+1;/p-1/t22?,29-,35?;/m0./s1 |
| InChIKey | QNJLKXCSRKQDKU-JQXPCOHGSA-M |
| XLogP | 3.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|