C28H41N3O4S — CID 54582853
(2S)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-N-[3-(4-methylpiperidin-1-yl)propyl]-3-phenylpropanamide (PubChem CID 54582853) has the molecular formula C28H41N3O4S and a molecular weight of 515.72 g/mol. Its IUPAC name is (2S)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-N-[3-(4-methylpiperidin-1-yl)propyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-N-[3-(4-methylpiperidin-1-yl)propyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 54582853 |
| Molecular Formula | C28H41N3O4S |
| Molecular Weight | 515.72 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | (2S)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-N-[3-(4-methylpiperidin-1-yl)propyl]-3-phenylpropanamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)NCCCN2CCC(C)CC2)c(C)c1C |
| InChI | InChI=1S/C28H41N3O4S/c1-20-12-16-31(17-13-20)15-9-14-29-28(32)25(19-24-10-7-6-8-11-24)30-36(33,34)27-21(2)18-26(35-5)22(3)23(27)4/h6-8,10-11,18,20,25,30H,9,12-17,19H2,1-5H3,(H,29,32)/t25-/m0/s1 |
| InChIKey | WQFRKAUIFBSTDZ-VWLOTQADSA-N |
| XLogP | 3.75 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.72 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|