C20H18ClN5O4S — CID 54582929
4-[[5-[(4-chlorophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]methyl]-6-nitro-1,4-benzoxazin-3-one (PubChem CID 54582929) has the molecular formula C20H18ClN5O4S and a molecular weight of 459.92 g/mol. Its IUPAC name is 4-[[5-[(4-chlorophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]methyl]-6-nitro-1,4-benzoxazin-3-one.
| Compound Name | 4-[[5-[(4-chlorophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]methyl]-6-nitro-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 54582929 |
| Molecular Formula | C20H18ClN5O4S |
| Molecular Weight | 459.92 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 4-[[5-[(4-chlorophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]methyl]-6-nitro-1,4-benzoxazin-3-one |
| SMILES | CCn1c(CN2C(=O)COc3ccc([N+](=O)[O-])cc32)nnc1SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClN5O4S/c1-2-24-18(22-23-20(24)31-12-13-3-5-14(21)6-4-13)10-25-16-9-15(26(28)29)7-8-17(16)30-11-19(25)27/h3-9H,2,10-12H2,1H3 |
| InChIKey | YIAFOAVSDIKDMZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.92 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|