C7H3F2N3O3 — CID 54583001
4,6-difluoro-7-nitro-1,2-dihydroindazol-3-one (PubChem CID 54583001) has the molecular formula C7H3F2N3O3 and a molecular weight of 215.11 g/mol. Its IUPAC name is 4,6-difluoro-7-nitro-1,2-dihydroindazol-3-one.
| Compound Name | 4,6-difluoro-7-nitro-1,2-dihydroindazol-3-one |
|---|---|
| PubChem CID | 54583001 |
| Molecular Formula | C7H3F2N3O3 |
| Molecular Weight | 215.11 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | 4,6-difluoro-7-nitro-1,2-dihydroindazol-3-one |
| SMILES | O=c1[nH][nH]c2c([N+](=O)[O-])c(F)cc(F)c12 |
| InChI | InChI=1S/C7H3F2N3O3/c8-2-1-3(9)6(12(14)15)5-4(2)7(13)11-10-5/h1H,(H2,10,11,13) |
| InChIKey | RXVLHIDBDAGCRZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.11 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|