C16H16ClF3N4O2S — CID 54583005
4-(4-chlorophenyl)-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]pyrimidin-2-amine (PubChem CID 54583005) has the molecular formula C16H16ClF3N4O2S and a molecular weight of 420.84 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]pyrimidin-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 54583005 |
| Molecular Formula | C16H16ClF3N4O2S |
| Molecular Weight | 420.84 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]pyrimidin-2-amine |
| SMILES | O=S(=O)(N1CCC(Nc2nccc(-c3ccc(Cl)cc3)n2)CC1)C(F)(F)F |
| InChI | InChI=1S/C16H16ClF3N4O2S/c17-12-3-1-11(2-4-12)14-5-8-21-15(23-14)22-13-6-9-24(10-7-13)27(25,26)16(18,19)20/h1-5,8,13H,6-7,9-10H2,(H,21,22,23) |
| InChIKey | JDAJYPUWHXSOJJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |