About 3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol
3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol (PubChem CID 54583007) has the molecular formula C23H29NO
and a molecular weight of 335.49 g/mol. Its IUPAC name is 3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol |
| PubChem CID | 54583007 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol |
| SMILES | CN1[C@@H]2CC[C@@H]1CC(CCC(O)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C23H29NO/c1-24-21-12-13-22(24)17-18(16-21)14-15-23(25,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,18,21-22,25H,12-17H2,1H3/t21-,22-/m1/s1 |
| InChIKey | SUUDZYHGMLHTBK-FGZHOGPDSA-N |
| XLogP | 4.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol?
The IUPAC name of 3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol (CID 54583007) is 3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol.
What is the SMILES notation for 3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol?
The canonical SMILES for 3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol is CN1[C@@H]2CC[C@@H]1CC(CCC(O)(c1ccccc1)c1ccccc1)C2.
What is the InChIKey of 3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol?
The InChIKey is SUUDZYHGMLHTBK-FGZHOGPDSA-N. The full InChI is InChI=1S/C23H29NO/c1-24-21-12-13-22(24)17-18(16-21)14-15-23(25,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,18,21-22,25H,12-17H2,1H3/t21-,22-/m1/s1.
What are the key properties of 3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol?
3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol has a molecular weight of 335.49 g/mol, XLogP of 4.58, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylpropan-1-ol is sourced from PubChem (CID 54583007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).