C32H43ClN6 — CID 54583090
3,9-dimethyl-1-N,7-N-bis(2-piperidin-1-ylethyl)quinolino[8,7-h]quinoline-1,7-diamine;hydrochloride (PubChem CID 54583090) has the molecular formula C32H43ClN6 and a molecular weight of 547.19 g/mol. Its IUPAC name is 3,9-dimethyl-1-N,7-N-bis(2-piperidin-1-ylethyl)quinolino[8,7-h]quinoline-1,7-diamine;hydrochloride.
| Compound Name | 3,9-dimethyl-1-N,7-N-bis(2-piperidin-1-ylethyl)quinolino[8,7-h]quinoline-1,7-diamine;hydrochloride |
|---|---|
| PubChem CID | 54583090 |
| Molecular Formula | C32H43ClN6 |
| Molecular Weight | 547.19 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | 3,9-dimethyl-1-N,7-N-bis(2-piperidin-1-ylethyl)quinolino[8,7-h]quinoline-1,7-diamine;hydrochloride |
| SMILES | Cc1cc(NCCN2CCCCC2)c2ccc3c(ccc4c(NCCN5CCCCC5)cc(C)nc43)c2n1.Cl |
| InChI | InChI=1S/C32H42N6.ClH/c1-23-21-29(33-13-19-37-15-5-3-6-16-37)27-11-10-26-25(31(27)35-23)9-12-28-30(22-24(2)36-32(26)28)34-14-20-38-17-7-4-8-18-38;/h9-12,21-22H,3-8,13-20H2,1-2H3,(H,33,35)(H,34,36);1H |
| InChIKey | SMIQMMYGRJSKCU-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.19 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|