C22H26OS2 — CID 54583135
(2'E)-2'-[(4-ethylphenyl)methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one (PubChem CID 54583135) has the molecular formula C22H26OS2 and a molecular weight of 370.58 g/mol. Its IUPAC name is (2'E)-2'-[(4-ethylphenyl)methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one.
| Compound Name | (2'E)-2'-[(4-ethylphenyl)methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 54583135 |
| Molecular Formula | C22H26OS2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2'E)-2'-[(4-ethylphenyl)methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
| SMILES | CCc1ccc(/C=C2\CCC3=CC4(CCC3(C)C2=O)SCCS4)cc1 |
| InChI | InChI=1S/C22H26OS2/c1-3-16-4-6-17(7-5-16)14-18-8-9-19-15-22(24-12-13-25-22)11-10-21(19,2)20(18)23/h4-7,14-15H,3,8-13H2,1-2H3/b18-14+ |
| InChIKey | TVRWCRNFAMCNOQ-NBVRZTHBSA-N |
| XLogP | 5.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|