C21H24O2S2 — CID 54583164
(2'E)-2'-[(4-methoxyphenyl)methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one (PubChem CID 54583164) has the molecular formula C21H24O2S2 and a molecular weight of 372.56 g/mol. Its IUPAC name is (2'E)-2'-[(4-methoxyphenyl)methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one.
| Compound Name | (2'E)-2'-[(4-methoxyphenyl)methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 54583164 |
| Molecular Formula | C21H24O2S2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (2'E)-2'-[(4-methoxyphenyl)methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
| SMILES | COc1ccc(/C=C2\CCC3=CC4(CCC3(C)C2=O)SCCS4)cc1 |
| InChI | InChI=1S/C21H24O2S2/c1-20-9-10-21(24-11-12-25-21)14-17(20)6-5-16(19(20)22)13-15-3-7-18(23-2)8-4-15/h3-4,7-8,13-14H,5-6,9-12H2,1-2H3/b16-13+ |
| InChIKey | MEOQSAKBRWHXPR-DTQAZKPQSA-N |
| XLogP | 5.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|