C23H30F3N3O — CID 54583210
3-[4-(4-methoxybutyl)-1-bicyclo[2.2.2]octanyl]-4-methyl-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole (PubChem CID 54583210) has the molecular formula C23H30F3N3O and a molecular weight of 421.51 g/mol. Its IUPAC name is 3-[4-(4-methoxybutyl)-1-bicyclo[2.2.2]octanyl]-4-methyl-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole.
| Compound Name | 3-[4-(4-methoxybutyl)-1-bicyclo[2.2.2]octanyl]-4-methyl-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 54583210 |
| Molecular Formula | C23H30F3N3O |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 3-[4-(4-methoxybutyl)-1-bicyclo[2.2.2]octanyl]-4-methyl-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole |
| SMILES | COCCCCC12CCC(c3nnc(-c4ccccc4C(F)(F)F)n3C)(CC1)CC2 |
| InChI | InChI=1S/C23H30F3N3O/c1-29-19(17-7-3-4-8-18(17)23(24,25)26)27-28-20(29)22-13-10-21(11-14-22,12-15-22)9-5-6-16-30-2/h3-4,7-8H,5-6,9-16H2,1-2H3 |
| InChIKey | BQIIPZMTXFQIQG-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|