C15H22ClNO2 — CID 54583277
(2S,3S)-2-(3-chlorophenyl)-4-ethyl-3,5,5-trimethylmorpholin-2-ol (PubChem CID 54583277) has the molecular formula C15H22ClNO2 and a molecular weight of 283.80 g/mol. Its IUPAC name is (2S,3S)-2-(3-chlorophenyl)-4-ethyl-3,5,5-trimethylmorpholin-2-ol.
| Compound Name | (2S,3S)-2-(3-chlorophenyl)-4-ethyl-3,5,5-trimethylmorpholin-2-ol |
|---|---|
| PubChem CID | 54583277 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (2S,3S)-2-(3-chlorophenyl)-4-ethyl-3,5,5-trimethylmorpholin-2-ol |
| SMILES | CCN1[C@@H](C)[C@](O)(c2cccc(Cl)c2)OCC1(C)C |
| InChI | InChI=1S/C15H22ClNO2/c1-5-17-11(2)15(18,19-10-14(17,3)4)12-7-6-8-13(16)9-12/h6-9,11,18H,5,10H2,1-4H3/t11-,15+/m0/s1 |
| InChIKey | VNRFZHXTMQEXQW-XHDPSFHLSA-N |
| XLogP | 3.00 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |