About 9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one
9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one (PubChem CID 54583333) has the molecular formula C19H25N3O
and a molecular weight of 311.43 g/mol. Its IUPAC name is 9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one.
Molecular Properties
| Compound Name | 9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one |
| PubChem CID | 54583333 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one |
| SMILES | CCCN1Cc2nc3c(CC(C)(C)C)cccc3c(N)c2C1=O |
| InChI | InChI=1S/C19H25N3O/c1-5-9-22-11-14-15(18(22)23)16(20)13-8-6-7-12(17(13)21-14)10-19(2,3)4/h6-8H,5,9-11H2,1-4H3,(H2,20,21) |
| InChIKey | JEUGTSHICBOMGA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one?
The IUPAC name of 9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one (CID 54583333) is 9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one.
What is the SMILES notation for 9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one?
The canonical SMILES for 9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one is CCCN1Cc2nc3c(CC(C)(C)C)cccc3c(N)c2C1=O.
What is the InChIKey of 9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one?
The InChIKey is JEUGTSHICBOMGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3O/c1-5-9-22-11-14-15(18(22)23)16(20)13-8-6-7-12(17(13)21-14)10-19(2,3)4/h6-8H,5,9-11H2,1-4H3,(H2,20,21).
What are the key properties of 9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one?
9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one has a molecular weight of 311.43 g/mol, XLogP of 3.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-5-(2,2-dimethylpropyl)-2-propyl-3H-pyrrolo[3,4-b]quinolin-1-one is sourced from PubChem (CID 54583333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).