C20H32N2O4 — CID 54583494
(2R,3R)-3-benzyl-2,4-dihydroxy-3-methyl-N-[3-oxo-3-(pentylamino)propyl]butanamide (PubChem CID 54583494) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is (2R,3R)-3-benzyl-2,4-dihydroxy-3-methyl-N-[3-oxo-3-(pentylamino)propyl]butanamide.
| Compound Name | (2R,3R)-3-benzyl-2,4-dihydroxy-3-methyl-N-[3-oxo-3-(pentylamino)propyl]butanamide |
|---|---|
| PubChem CID | 54583494 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (2R,3R)-3-benzyl-2,4-dihydroxy-3-methyl-N-[3-oxo-3-(pentylamino)propyl]butanamide |
| SMILES | CCCCCNC(=O)CCNC(=O)[C@H](O)[C@@](C)(CO)Cc1ccccc1 |
| InChI | InChI=1S/C20H32N2O4/c1-3-4-8-12-21-17(24)11-13-22-19(26)18(25)20(2,15-23)14-16-9-6-5-7-10-16/h5-7,9-10,18,23,25H,3-4,8,11-15H2,1-2H3,(H,21,24)(H,22,26)/t18-,20+/m0/s1 |
| InChIKey | ZRYZSLPRUIQQNG-AZUAARDMSA-N |
| XLogP | 1.40 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|