About 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid
6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid (PubChem CID 54583568) has the molecular formula C20H19N3O3S
and a molecular weight of 381.46 g/mol. Its IUPAC name is 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid |
| PubChem CID | 54583568 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid |
| SMILES | CN(CCOc1ccc2cc(C(=O)O)n(C)c2c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H19N3O3S/c1-22(20-21-15-5-3-4-6-18(15)27-20)9-10-26-14-8-7-13-11-17(19(24)25)23(2)16(13)12-14/h3-8,11-12H,9-10H2,1-2H3,(H,24,25) |
| InChIKey | QBMUMPQHSKKGNP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid?
The IUPAC name of 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid (CID 54583568) is 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid.
What is the SMILES notation for 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid?
The canonical SMILES for 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid is CN(CCOc1ccc2cc(C(=O)O)n(C)c2c1)c1nc2ccccc2s1.
What is the InChIKey of 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid?
The InChIKey is QBMUMPQHSKKGNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O3S/c1-22(20-21-15-5-3-4-6-18(15)27-20)9-10-26-14-8-7-13-11-17(19(24)25)23(2)16(13)12-14/h3-8,11-12H,9-10H2,1-2H3,(H,24,25).
What are the key properties of 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid?
6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid has a molecular weight of 381.46 g/mol, XLogP of 4.00, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]-1-methylindole-2-carboxylic acid is sourced from PubChem (CID 54583568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).