About N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide
N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide (PubChem CID 54583639) has the molecular formula C22H25N3OS
and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 54583639 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1sc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H25N3OS/c1-3-25(4-2)16-15-23-21(26)20-19(17-11-7-5-8-12-17)24-22(27-20)18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3,(H,23,26) |
| InChIKey | WDQKBUQPNOSCQU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide (CID 54583639) is N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide is CCN(CC)CCNC(=O)c1sc(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide?
The InChIKey is WDQKBUQPNOSCQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3OS/c1-3-25(4-2)16-15-23-21(26)20-19(17-11-7-5-8-12-17)24-22(27-20)18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3,(H,23,26).
What are the key properties of N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide?
N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide has a molecular weight of 379.53 g/mol, XLogP of 4.55, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(diethylamino)ethyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 54583639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).