About N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride
N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride (PubChem CID 54583641) has the molecular formula C27H26ClN3O
and a molecular weight of 443.98 g/mol. Its IUPAC name is N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride.
Molecular Properties
| Compound Name | N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride |
| PubChem CID | 54583641 |
| Molecular Formula | C27H26ClN3O |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride |
| SMILES | CCN(CC)c1ccc2nc3c4ccccc4/c(=N/c4ccc(C)cc4)cc-3oc2c1.Cl |
| InChI | InChI=1S/C27H25N3O.ClH/c1-4-30(5-2)20-14-15-23-25(16-20)31-26-17-24(28-19-12-10-18(3)11-13-19)21-8-6-7-9-22(21)27(26)29-23;/h6-17H,4-5H2,1-3H3;1H/b28-24+; |
| InChIKey | KWSKDXPLYVPOFU-YTGAECEWSA-N |
| XLogP | 6.89 |
| TPSA | 41.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride?
The IUPAC name of N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride (CID 54583641) is N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride.
What is the SMILES notation for N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride?
The canonical SMILES for N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride is CCN(CC)c1ccc2nc3c4ccccc4/c(=N/c4ccc(C)cc4)cc-3oc2c1.Cl.
What is the InChIKey of N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride?
The InChIKey is KWSKDXPLYVPOFU-YTGAECEWSA-N. The full InChI is InChI=1S/C27H25N3O.ClH/c1-4-30(5-2)20-14-15-23-25(16-20)31-26-17-24(28-19-12-10-18(3)11-13-19)21-8-6-7-9-22(21)27(26)29-23;/h6-17H,4-5H2,1-3H3;1H/b28-24+;.
What are the key properties of N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride?
N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride has a molecular weight of 443.98 g/mol, XLogP of 6.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-5-(4-methylphenyl)iminobenzo[a]phenoxazin-9-amine;hydrochloride is sourced from PubChem (CID 54583641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).