C22H22N2OS — CID 54583721
(5E)-5-benzylidene-3-cyclohexyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 54583721) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is (5E)-5-benzylidene-3-cyclohexyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-benzylidene-3-cyclohexyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 54583721 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (5E)-5-benzylidene-3-cyclohexyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccccc2)S/C(=N\c2ccccc2)N1C1CCCCC1 |
| InChI | InChI=1S/C22H22N2OS/c25-21-20(16-17-10-4-1-5-11-17)26-22(23-18-12-6-2-7-13-18)24(21)19-14-8-3-9-15-19/h1-2,4-7,10-13,16,19H,3,8-9,14-15H2/b20-16+,23-22- |
| InChIKey | GREKRRJHAWDIHC-SUJVXMJXSA-N |
| XLogP | 5.62 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|