C14H16BrNS2 — CID 54583746
(4R,9aS)-4-thiophen-2-yl-4,5,7,8,9,9a-hexahydrothieno[2,3-g]indolizine;hydrobromide (PubChem CID 54583746) has the molecular formula C14H16BrNS2 and a molecular weight of 342.33 g/mol. Its IUPAC name is (4R,9aS)-4-thiophen-2-yl-4,5,7,8,9,9a-hexahydrothieno[2,3-g]indolizine;hydrobromide.
| Compound Name | (4R,9aS)-4-thiophen-2-yl-4,5,7,8,9,9a-hexahydrothieno[2,3-g]indolizine;hydrobromide |
|---|---|
| PubChem CID | 54583746 |
| Molecular Formula | C14H16BrNS2 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | (4R,9aS)-4-thiophen-2-yl-4,5,7,8,9,9a-hexahydrothieno[2,3-g]indolizine;hydrobromide |
| SMILES | Br.c1csc([C@H]2CN3CCC[C@H]3c3ccsc32)c1 |
| InChI | InChI=1S/C14H15NS2.BrH/c1-3-12-10-5-8-17-14(10)11(9-15(12)6-1)13-4-2-7-16-13;/h2,4-5,7-8,11-12H,1,3,6,9H2;1H/t11-,12+;/m1./s1 |
| InChIKey | FZJAVBJTFJDHPI-LYCTWNKOSA-N |
| XLogP | 4.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |