C11H12ClNO3 — CID 54583760
(2S,4S)-4-(2-chlorophenoxy)pyrrolidine-2-carboxylic acid (PubChem CID 54583760) has the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. Its IUPAC name is (2S,4S)-4-(2-chlorophenoxy)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-(2-chlorophenoxy)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54583760 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | (2S,4S)-4-(2-chlorophenoxy)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](Oc2ccccc2Cl)CN1 |
| InChI | InChI=1S/C11H12ClNO3/c12-8-3-1-2-4-10(8)16-7-5-9(11(14)15)13-6-7/h1-4,7,9,13H,5-6H2,(H,14,15)/t7-,9-/m0/s1 |
| InChIKey | YOTPHSWLNODHHM-CBAPKCEASA-N |
| XLogP | 1.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |