C16H25BF4O6S — CID 54583811
(2R,3S,4S)-1-[(2S,3S)-2,4-dihydroxy-3-phenylmethoxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol tetrafluoroborate (PubChem CID 54583811) has the molecular formula C16H25BF4O6S and a molecular weight of 432.24 g/mol. Its IUPAC name is (2R,3S,4S)-1-[(2S,3S)-2,4-dihydroxy-3-phenylmethoxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol tetrafluoroborate.
| Compound Name | (2R,3S,4S)-1-[(2S,3S)-2,4-dihydroxy-3-phenylmethoxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol tetrafluoroborate |
|---|---|
| PubChem CID | 54583811 |
| Molecular Formula | C16H25BF4O6S |
| Molecular Weight | 432.24 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (2R,3S,4S)-1-[(2S,3S)-2,4-dihydroxy-3-phenylmethoxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol tetrafluoroborate |
| SMILES | F[B-](F)(F)F.OC[C@H](OCc1ccccc1)[C@H](O)C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C16H25O6S.BF4/c17-6-14(22-8-11-4-2-1-3-5-11)12(19)9-23-10-13(20)16(21)15(23)7-18;2-1(3,4)5/h1-5,12-21H,6-10H2;/q+1;-1/t12-,13-,14+,15-,16+,23?;/m1./s1 |
| InChIKey | YVENXOIJVKDSMY-HPCKVWKKSA-N |
| XLogP | -0.06 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|