C22H23F3N2O2 — CID 54583840
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate (PubChem CID 54583840) has the molecular formula C22H23F3N2O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 54583840 |
| Molecular Formula | C22H23F3N2O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate |
| SMILES | Cc1cccc(N(Cc2cc(F)c(F)cc2F)C(=O)O[C@H]2CN3CCC2CC3)c1 |
| InChI | InChI=1S/C22H23F3N2O2/c1-14-3-2-4-17(9-14)27(12-16-10-19(24)20(25)11-18(16)23)22(28)29-21-13-26-7-5-15(21)6-8-26/h2-4,9-11,15,21H,5-8,12-13H2,1H3/t21-/m0/s1 |
| InChIKey | WRQCVLFZYUVEBT-NRFANRHFSA-N |
| XLogP | 4.65 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|