C21H24ClN3O — CID 5458388
3-(9-methoxy-5,11-dimethyl-2H-pyrido[4,3-b]carbazol-6-ium-6-yl)propan-1-amine chloride (PubChem CID 5458388) has the molecular formula C21H24ClN3O and a molecular weight of 369.90 g/mol. Its IUPAC name is 3-(9-methoxy-5,11-dimethyl-2H-pyrido[4,3-b]carbazol-6-ium-6-yl)propan-1-amine chloride.
| Compound Name | 3-(9-methoxy-5,11-dimethyl-2H-pyrido[4,3-b]carbazol-6-ium-6-yl)propan-1-amine chloride |
|---|---|
| PubChem CID | 5458388 |
| Molecular Formula | C21H24ClN3O |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 3-(9-methoxy-5,11-dimethyl-2H-pyrido[4,3-b]carbazol-6-ium-6-yl)propan-1-amine chloride |
| SMILES | COc1ccc2c(c1)c1c(C)c3c[nH]ccc3c(C)c1[n+]2CCCN.[Cl-] |
| InChI | InChI=1S/C21H23N3O.ClH/c1-13-18-12-23-9-7-16(18)14(2)21-20(13)17-11-15(25-3)5-6-19(17)24(21)10-4-8-22;/h5-7,9,11-12H,4,8,10,22H2,1-3H3;1H |
| InChIKey | VFENHZVXEDVOAK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 54.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|