C29H40O3 — CID 54583914
methyl (1R,4S,5R,9S,10S,13R,14S)-4,5,9-trimethyl-15-oxo-14-(2-phenylethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 54583914) has the molecular formula C29H40O3 and a molecular weight of 436.64 g/mol. Its IUPAC name is methyl (1R,4S,5R,9S,10S,13R,14S)-4,5,9-trimethyl-15-oxo-14-(2-phenylethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | methyl (1R,4S,5R,9S,10S,13R,14S)-4,5,9-trimethyl-15-oxo-14-(2-phenylethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 54583914 |
| Molecular Formula | C29H40O3 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | methyl (1R,4S,5R,9S,10S,13R,14S)-4,5,9-trimethyl-15-oxo-14-(2-phenylethyl)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@H]4C[C@@]3(CC[C@]12C)C(=O)[C@H]4CCc1ccccc1 |
| InChI | InChI=1S/C29H40O3/c1-26-15-8-16-27(2,25(31)32-4)28(26,3)17-18-29-19-21(12-14-23(26)29)22(24(29)30)13-11-20-9-6-5-7-10-20/h5-7,9-10,21-23H,8,11-19H2,1-4H3/t21-,22+,23+,26+,27+,28+,29-/m1/s1 |
| InChIKey | FJSOYLCPMQPEBO-XWDLSYDWSA-N |
| XLogP | 6.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |