C10H13N5O — CID 54583944
(7R)-1,4,7-trimethyl-7,8-dihydroimidazo[2,1-f]purin-5-one (PubChem CID 54583944) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is (7R)-1,4,7-trimethyl-7,8-dihydroimidazo[2,1-f]purin-5-one.
| Compound Name | (7R)-1,4,7-trimethyl-7,8-dihydroimidazo[2,1-f]purin-5-one |
|---|---|
| PubChem CID | 54583944 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | (7R)-1,4,7-trimethyl-7,8-dihydroimidazo[2,1-f]purin-5-one |
| SMILES | C[C@@H]1CN=C2c3c(ncn3C)N(C)C(=O)N21 |
| InChI | InChI=1S/C10H13N5O/c1-6-4-11-9-7-8(12-5-13(7)2)14(3)10(16)15(6)9/h5-6H,4H2,1-3H3/t6-/m1/s1 |
| InChIKey | HKISLJPSAZWGQZ-ZCFIWIBFSA-N |
| XLogP | 0.44 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |