C17H20N8O — CID 54583961
7-amino-4-benzyl-10-[2-(dimethylamino)ethyl]-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-5-one (PubChem CID 54583961) has the molecular formula C17H20N8O and a molecular weight of 352.40 g/mol. Its IUPAC name is 7-amino-4-benzyl-10-[2-(dimethylamino)ethyl]-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-5-one.
| Compound Name | 7-amino-4-benzyl-10-[2-(dimethylamino)ethyl]-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-5-one |
|---|---|
| PubChem CID | 54583961 |
| Molecular Formula | C17H20N8O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 7-amino-4-benzyl-10-[2-(dimethylamino)ethyl]-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-5-one |
| SMILES | CN(C)CCn1ncc2c1nc(N)n1c(=O)n(Cc3ccccc3)nc21 |
| InChI | InChI=1S/C17H20N8O/c1-22(2)8-9-23-14-13(10-19-23)15-21-24(11-12-6-4-3-5-7-12)17(26)25(15)16(18)20-14/h3-7,10H,8-9,11H2,1-2H3,(H2,18,20) |
| InChIKey | ZTCPCFPNHRIZTE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |