C34H42O5 — CID 54584054
[(2Z)-2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-5-yl] (10E,12Z)-octadeca-10,12-dienoate (PubChem CID 54584054) has the molecular formula C34H42O5 and a molecular weight of 530.71 g/mol. Its IUPAC name is [(2Z)-2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-5-yl] (10E,12Z)-octadeca-10,12-dienoate.
| Compound Name | [(2Z)-2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-5-yl] (10E,12Z)-octadeca-10,12-dienoate |
|---|---|
| PubChem CID | 54584054 |
| Molecular Formula | C34H42O5 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | [(2Z)-2-[(3-methoxyphenyl)methylidene]-3-oxo-1-benzofuran-5-yl] (10E,12Z)-octadeca-10,12-dienoate |
| SMILES | CCCCC/C=C\C=C\CCCCCCCCC(=O)Oc1ccc2c(c1)C(=O)/C(=C/c1cccc(OC)c1)O2 |
| InChI | InChI=1S/C34H42O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-33(35)38-29-22-23-31-30(26-29)34(36)32(39-31)25-27-19-18-20-28(24-27)37-2/h7-10,18-20,22-26H,3-6,11-17,21H2,1-2H3/b8-7-,10-9+,32-25- |
| InChIKey | FQCLOGSINYFFJA-HLMZYKILSA-N |
| XLogP | 9.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|