C22H24Cl2N2O — CID 54584216
(1S,2S,4R,5R)-2,4-bis(2-chlorophenyl)-N-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-imine (PubChem CID 54584216) has the molecular formula C22H24Cl2N2O and a molecular weight of 403.35 g/mol. Its IUPAC name is (1S,2S,4R,5R)-2,4-bis(2-chlorophenyl)-N-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-imine.
| Compound Name | (1S,2S,4R,5R)-2,4-bis(2-chlorophenyl)-N-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-imine |
|---|---|
| PubChem CID | 54584216 |
| Molecular Formula | C22H24Cl2N2O |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (1S,2S,4R,5R)-2,4-bis(2-chlorophenyl)-N-methoxy-3-methyl-3-azabicyclo[3.3.1]nonan-9-imine |
| SMILES | CO/N=C1\[C@H]2CCC[C@@H]1[C@H](c1ccccc1Cl)N(C)[C@@H]2c1ccccc1Cl |
| InChI | InChI=1S/C22H24Cl2N2O/c1-26-21(14-8-3-5-12-18(14)23)16-10-7-11-17(20(16)25-27-2)22(26)15-9-4-6-13-19(15)24/h3-6,8-9,12-13,16-17,21-22H,7,10-11H2,1-2H3/b25-20-/t16-,17+,21-,22+/m0/s1 |
| InChIKey | FOHLMNPQRSAXOG-UWBRFDQESA-N |
| XLogP | 6.14 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|