C16H24ClNO2 — CID 54584239
(2S,3S)-2-(3-chlorophenyl)-3,5,5-trimethyl-4-propylmorpholin-2-ol (PubChem CID 54584239) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is (2S,3S)-2-(3-chlorophenyl)-3,5,5-trimethyl-4-propylmorpholin-2-ol.
| Compound Name | (2S,3S)-2-(3-chlorophenyl)-3,5,5-trimethyl-4-propylmorpholin-2-ol |
|---|---|
| PubChem CID | 54584239 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (2S,3S)-2-(3-chlorophenyl)-3,5,5-trimethyl-4-propylmorpholin-2-ol |
| SMILES | CCCN1[C@@H](C)[C@](O)(c2cccc(Cl)c2)OCC1(C)C |
| InChI | InChI=1S/C16H24ClNO2/c1-5-9-18-12(2)16(19,20-11-15(18,3)4)13-7-6-8-14(17)10-13/h6-8,10,12,19H,5,9,11H2,1-4H3/t12-,16+/m0/s1 |
| InChIKey | XNZHLLAIQAZMMY-BLLLJJGKSA-N |
| XLogP | 3.39 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |