About N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine
N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine (PubChem CID 54584243) has the molecular formula C26H23N7O
and a molecular weight of 449.52 g/mol. Its IUPAC name is N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine.
Molecular Properties
| Compound Name | N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine |
| PubChem CID | 54584243 |
| Molecular Formula | C26H23N7O |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine |
| SMILES | c1ccc(-c2cccc3cnc(Nc4ccc(-n5cnc(N6CCOCC6)n5)cc4)nc23)cc1 |
| InChI | InChI=1S/C26H23N7O/c1-2-5-19(6-3-1)23-8-4-7-20-17-27-25(30-24(20)23)29-21-9-11-22(12-10-21)33-18-28-26(31-33)32-13-15-34-16-14-32/h1-12,17-18H,13-16H2,(H,27,29,30) |
| InChIKey | BILUVSXSPJVCMC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine?
The IUPAC name of N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine (CID 54584243) is N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine.
What is the SMILES notation for N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine?
The canonical SMILES for N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine is c1ccc(-c2cccc3cnc(Nc4ccc(-n5cnc(N6CCOCC6)n5)cc4)nc23)cc1.
What is the InChIKey of N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine?
The InChIKey is BILUVSXSPJVCMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23N7O/c1-2-5-19(6-3-1)23-8-4-7-20-17-27-25(30-24(20)23)29-21-9-11-22(12-10-21)33-18-28-26(31-33)32-13-15-34-16-14-32/h1-12,17-18H,13-16H2,(H,27,29,30).
What are the key properties of N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine?
N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine has a molecular weight of 449.52 g/mol, XLogP of 4.46, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-8-phenylquinazolin-2-amine is sourced from PubChem (CID 54584243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).