C15H21BrCl2O — CID 54584270
(3Z,9Z)-13-bromo-7,12-dichloropentadeca-3,9-dien-1-yn-6-ol (PubChem CID 54584270) has the molecular formula C15H21BrCl2O and a molecular weight of 368.14 g/mol. Its IUPAC name is (3Z,9Z)-13-bromo-7,12-dichloropentadeca-3,9-dien-1-yn-6-ol.
| Compound Name | (3Z,9Z)-13-bromo-7,12-dichloropentadeca-3,9-dien-1-yn-6-ol |
|---|---|
| PubChem CID | 54584270 |
| Molecular Formula | C15H21BrCl2O |
| Molecular Weight | 368.14 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | (3Z,9Z)-13-bromo-7,12-dichloropentadeca-3,9-dien-1-yn-6-ol |
| SMILES | C#C/C=C\CC(O)C(Cl)C/C=C\CC(Cl)C(Br)CC |
| InChI | InChI=1S/C15H21BrCl2O/c1-3-5-6-11-15(19)14(18)10-8-7-9-13(17)12(16)4-2/h1,5-8,12-15,19H,4,9-11H2,2H3/b6-5-,8-7- |
| InChIKey | GGOGTQISOAHDFM-ISTTXYCBSA-N |
| XLogP | 4.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.14 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|