C29H43BN4O7 — CID 54584387
[(1R)-3-methyl-1-[[(5S)-5-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-6-(naphthalen-2-ylmethylamino)-6-oxohexanoyl]amino]butyl]boronic acid (PubChem CID 54584387) has the molecular formula C29H43BN4O7 and a molecular weight of 570.50 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[(5S)-5-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-6-(naphthalen-2-ylmethylamino)-6-oxohexanoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[(5S)-5-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-6-(naphthalen-2-ylmethylamino)-6-oxohexanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 54584387 |
| Molecular Formula | C29H43BN4O7 |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | [(1R)-3-methyl-1-[[(5S)-5-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-6-(naphthalen-2-ylmethylamino)-6-oxohexanoyl]amino]butyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)CCC[C@H](NC(=O)CNC(=O)OC(C)(C)C)C(=O)NCc1ccc2ccccc2c1)B(O)O |
| InChI | InChI=1S/C29H43BN4O7/c1-19(2)15-24(30(39)40)34-25(35)12-8-11-23(33-26(36)18-32-28(38)41-29(3,4)5)27(37)31-17-20-13-14-21-9-6-7-10-22(21)16-20/h6-7,9-10,13-14,16,19,23-24,39-40H,8,11-12,15,17-18H2,1-5H3,(H,31,37)(H,32,38)(H,33,36)(H,34,35)/t23-,24-/m0/s1 |
| InChIKey | SSXPMEGFFVUGLY-ZEQRLZLVSA-N |
| XLogP | 2.18 |
| TPSA | 166.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|