About 2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide
2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide (PubChem CID 54584457) has the molecular formula C10H21IN2O3
and a molecular weight of 344.19 g/mol. Its IUPAC name is 2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide.
Molecular Properties
| Compound Name | 2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide |
| PubChem CID | 54584457 |
| Molecular Formula | C10H21IN2O3 |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide |
| SMILES | COCCOC(=O)N1CC[N+](C)(C)CC1.[I-] |
| InChI | InChI=1S/C10H21N2O3.HI/c1-12(2)6-4-11(5-7-12)10(13)15-9-8-14-3;/h4-9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | OCMNBNMAFWRQCQ-UHFFFAOYSA-M |
| XLogP | -2.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide?
The IUPAC name of 2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide (CID 54584457) is 2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide.
What is the SMILES notation for 2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide?
The canonical SMILES for 2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide is COCCOC(=O)N1CC[N+](C)(C)CC1.[I-].
What is the InChIKey of 2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide?
The InChIKey is OCMNBNMAFWRQCQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H21N2O3.HI/c1-12(2)6-4-11(5-7-12)10(13)15-9-8-14-3;/h4-9H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide?
2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide has a molecular weight of 344.19 g/mol, XLogP of -2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 4,4-dimethylpiperazin-4-ium-1-carboxylate iodide is sourced from PubChem (CID 54584457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).