About 4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine
4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 54584505) has the molecular formula C14H10Cl2FN3O
and a molecular weight of 326.16 g/mol. Its IUPAC name is 4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 54584505 |
| Molecular Formula | C14H10Cl2FN3O |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | COc1cc(-c2nc(C)nc3[nH]cc(F)c23)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2FN3O/c1-6-19-13(12-10(17)5-18-14(12)20-6)7-3-11(21-2)9(16)4-8(7)15/h3-5H,1-2H3,(H,18,19,20) |
| InChIKey | HZSHCNIPKGQMCM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine (CID 54584505) is 4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine is COc1cc(-c2nc(C)nc3[nH]cc(F)c23)c(Cl)cc1Cl.
What is the InChIKey of 4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is HZSHCNIPKGQMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2FN3O/c1-6-19-13(12-10(17)5-18-14(12)20-6)7-3-11(21-2)9(16)4-8(7)15/h3-5H,1-2H3,(H,18,19,20).
What are the key properties of 4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine?
4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 326.16 g/mol, XLogP of 4.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichloro-5-methoxyphenyl)-5-fluoro-2-methyl-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 54584505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).