About ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate
ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate (PubChem CID 54584604) has the molecular formula C14H14O5S
and a molecular weight of 294.33 g/mol. Its IUPAC name is ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate |
| PubChem CID | 54584604 |
| Molecular Formula | C14H14O5S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate |
| SMILES | CCOC(=O)C12C(=O)OCC=C1COC2c1cccs1 |
| InChI | InChI=1S/C14H14O5S/c1-2-17-12(15)14-9(5-6-18-13(14)16)8-19-11(14)10-4-3-7-20-10/h3-5,7,11H,2,6,8H2,1H3 |
| InChIKey | JOMLEBGPMNYPRG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate?
The IUPAC name of ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate (CID 54584604) is ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate.
What is the SMILES notation for ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate?
The canonical SMILES for ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate is CCOC(=O)C12C(=O)OCC=C1COC2c1cccs1.
What is the InChIKey of ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate?
The InChIKey is JOMLEBGPMNYPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O5S/c1-2-17-12(15)14-9(5-6-18-13(14)16)8-19-11(14)10-4-3-7-20-10/h3-5,7,11H,2,6,8H2,1H3.
What are the key properties of ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate?
ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate has a molecular weight of 294.33 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxo-3-thiophen-2-yl-3,6-dihydro-1H-furo[3,4-c]pyran-3a-carboxylate is sourced from PubChem (CID 54584604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).