About N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride
N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride (PubChem CID 54584691) has the molecular formula C14H21Cl3N2O2
and a molecular weight of 355.69 g/mol. Its IUPAC name is N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride.
Molecular Properties
| Compound Name | N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride |
| PubChem CID | 54584691 |
| Molecular Formula | C14H21Cl3N2O2 |
| Molecular Weight | 355.69 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride |
| SMILES | CC(C)C(=O)NCCNCC(O)c1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C14H20Cl2N2O2.ClH/c1-9(2)14(20)18-6-5-17-8-13(19)11-4-3-10(15)7-12(11)16;/h3-4,7,9,13,17,19H,5-6,8H2,1-2H3,(H,18,20);1H |
| InChIKey | PNOYXWBVEUXWFQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.69 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride?
The IUPAC name of N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride (CID 54584691) is N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride.
What is the SMILES notation for N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride?
The canonical SMILES for N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride is CC(C)C(=O)NCCNCC(O)c1ccc(Cl)cc1Cl.Cl.
What is the InChIKey of N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride?
The InChIKey is PNOYXWBVEUXWFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20Cl2N2O2.ClH/c1-9(2)14(20)18-6-5-17-8-13(19)11-4-3-10(15)7-12(11)16;/h3-4,7,9,13,17,19H,5-6,8H2,1-2H3,(H,18,20);1H.
What are the key properties of N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride?
N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride has a molecular weight of 355.69 g/mol, XLogP of 2.81, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride is sourced from PubChem (CID 54584691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).