About 2-(4''-(Ethylsulfonyl)-2''-methyl-5-(trifluoromethyl)biphenyl-2-yloxy)butanoic acid
2-(4''-(Ethylsulfonyl)-2''-methyl-5-(trifluoromethyl)biphenyl-2-yloxy)butanoic acid (PubChem CID 54584708) has the molecular formula C20H21F3O5S
and a molecular weight of 430.40 g/mol. Its IUPAC name is 2-[2-(4-ethylsulfonyl-2-methylphenyl)-4-(trifluoromethyl)phenoxy]butanoic acid.
Molecular Properties
| Compound Name | 2-(4''-(Ethylsulfonyl)-2''-methyl-5-(trifluoromethyl)biphenyl-2-yloxy)butanoic acid |
| PubChem CID | 54584708 |
| Molecular Formula | C20H21F3O5S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-[2-(4-ethylsulfonyl-2-methylphenyl)-4-(trifluoromethyl)phenoxy]butanoic acid |
| SMILES | CCC(C(=O)O)OC1=C(C=C(C=C1)C(F)(F)F)C2=C(C=C(C=C2)S(=O)(=O)CC)C |
| InChI | InChI=1S/C20H21F3O5S/c1-4-17(19(24)25)28-18-9-6-13(20(21,22)23)11-16(18)15-8-7-14(10-12(15)3)29(26,27)5-2/h6-11,17H,4-5H2,1-3H3,(H,24,25) |
| InChIKey | GCJIORHCPZEYFY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | 658 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(4''-(Ethylsulfonyl)-2''-methyl-5-(trifluoromethyl)biphenyl-2-yloxy)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4''-(Ethylsulfonyl)-2''-methyl-5-(trifluoromethyl)biphenyl-2-yloxy)butanoic acid?
The IUPAC name of 2-(4''-(Ethylsulfonyl)-2''-methyl-5-(trifluoromethyl)biphenyl-2-yloxy)butanoic acid (CID 54584708) is 2-[2-(4-ethylsulfonyl-2-methylphenyl)-4-(trifluoromethyl)phenoxy]butanoic acid.
What is the SMILES notation for 2-(4''-(Ethylsulfonyl)-2''-methyl-5-(trifluoromethyl)biphenyl-2-yloxy)butanoic acid?
The canonical SMILES for 2-(4''-(Ethylsulfonyl)-2''-methyl-5-(trifluoromethyl)biphenyl-2-yloxy)butanoic acid is CCC(C(=O)O)OC1=C(C=C(C=C1)C(F)(F)F)C2=C(C=C(C=C2)S(=O)(=O)CC)C.
What is the InChIKey of 2-(4''-(Ethylsulfonyl)-2''-methyl-5-(trifluoromethyl)biphenyl-2-yloxy)butanoic acid?
The InChIKey is GCJIORHCPZEYFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21F3O5S/c1-4-17(19(24)25)28-18-9-6-13(20(21,22)23)11-16(18)15-8-7-14(10-12(15)3)29(26,27)5-2/h6-11,17H,4-5H2,1-3H3,(H,24,25).
What are the key properties of 2-(4''-(Ethylsulfonyl)-2''-methyl-5-(trifluoromethyl)biphenyl-2-yloxy)butanoic acid?
2-(4''-(Ethylsulfonyl)-2''-methyl-5-(trifluoromethyl)biphenyl-2-yloxy)butanoic acid has a molecular weight of 430.40 g/mol, XLogP of 4.90, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4''-(Ethylsulfonyl)-2''-methyl-5-(trifluoromethyl)biphenyl-2-yloxy)butanoic acid is sourced from PubChem (CID 54584708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).