About 2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate
2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate (PubChem CID 54584837) has the molecular formula C18H21N3O5S
and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate.
Molecular Properties
| Compound Name | 2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate |
| PubChem CID | 54584837 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate |
| SMILES | CN(C)CCc1cn(CCOS(C)(=O)=O)c2c1C(=O)c1ccncc1C2=O |
| InChI | InChI=1S/C18H21N3O5S/c1-20(2)7-5-12-11-21(8-9-26-27(3,24)25)16-15(12)17(22)13-4-6-19-10-14(13)18(16)23/h4,6,10-11H,5,7-9H2,1-3H3 |
| InChIKey | DCLGOILZSIADOR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate?
The IUPAC name of 2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate (CID 54584837) is 2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate.
What is the SMILES notation for 2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate?
The canonical SMILES for 2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate is CN(C)CCc1cn(CCOS(C)(=O)=O)c2c1C(=O)c1ccncc1C2=O.
What is the InChIKey of 2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate?
The InChIKey is DCLGOILZSIADOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O5S/c1-20(2)7-5-12-11-21(8-9-26-27(3,24)25)16-15(12)17(22)13-4-6-19-10-14(13)18(16)23/h4,6,10-11H,5,7-9H2,1-3H3.
What are the key properties of 2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate?
2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate has a molecular weight of 391.45 g/mol, XLogP of 0.74, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]ethyl methanesulfonate is sourced from PubChem (CID 54584837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).