C22H32O3 — CID 54584858
methyl (1R,4S,5R,9S,10S,13R)-4,5,9-trimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 54584858) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is methyl (1R,4S,5R,9S,10S,13R)-4,5,9-trimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | methyl (1R,4S,5R,9S,10S,13R)-4,5,9-trimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 54584858 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | methyl (1R,4S,5R,9S,10S,13R)-4,5,9-trimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | C=C1C(=O)[C@@]23CC[C@]4(C)[C@](C)(C(=O)OC)CCC[C@@]4(C)[C@@H]2CC[C@@H]1C3 |
| InChI | InChI=1S/C22H32O3/c1-14-15-7-8-16-19(2)9-6-10-20(3,18(24)25-5)21(19,4)11-12-22(16,13-15)17(14)23/h15-16H,1,6-13H2,2-5H3/t15-,16+,19+,20+,21+,22-/m1/s1 |
| InChIKey | HUJFBSWHJNEQAA-KDVJAKETSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|