About 7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid
7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid (PubChem CID 54584878) has the molecular formula C26H22O3
and a molecular weight of 382.46 g/mol. Its IUPAC name is 7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid |
| PubChem CID | 54584878 |
| Molecular Formula | C26H22O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid |
| SMILES | Cc1cccc(C)c1COc1ccc2c(-c3ccccc3)cc(C(=O)O)cc2c1 |
| InChI | InChI=1S/C26H22O3/c1-17-7-6-8-18(2)25(17)16-29-22-11-12-23-20(14-22)13-21(26(27)28)15-24(23)19-9-4-3-5-10-19/h3-15H,16H2,1-2H3,(H,27,28) |
| InChIKey | HIVWZRSQGPEXRC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid?
The IUPAC name of 7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid (CID 54584878) is 7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid.
What is the SMILES notation for 7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid?
The canonical SMILES for 7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid is Cc1cccc(C)c1COc1ccc2c(-c3ccccc3)cc(C(=O)O)cc2c1.
What is the InChIKey of 7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid?
The InChIKey is HIVWZRSQGPEXRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22O3/c1-17-7-6-8-18(2)25(17)16-29-22-11-12-23-20(14-22)13-21(26(27)28)15-24(23)19-9-4-3-5-10-19/h3-15H,16H2,1-2H3,(H,27,28).
What are the key properties of 7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid?
7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid has a molecular weight of 382.46 g/mol, XLogP of 6.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2,6-dimethylphenyl)methoxy]-4-phenylnaphthalene-2-carboxylic acid is sourced from PubChem (CID 54584878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).