C25H13F9O4S — CID 54584880
4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)thiophen-3-yl]-7-[4-(trifluoromethoxy)phenyl]naphthalene-2-carboxylic acid (PubChem CID 54584880) has the molecular formula C25H13F9O4S and a molecular weight of 580.42 g/mol. Its IUPAC name is 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)thiophen-3-yl]-7-[4-(trifluoromethoxy)phenyl]naphthalene-2-carboxylic acid.
| Compound Name | 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)thiophen-3-yl]-7-[4-(trifluoromethoxy)phenyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 54584880 |
| Molecular Formula | C25H13F9O4S |
| Molecular Weight | 580.42 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)thiophen-3-yl]-7-[4-(trifluoromethoxy)phenyl]naphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cscc2C(O)(C(F)(F)F)C(F)(F)F)c2ccc(-c3ccc(OC(F)(F)F)cc3)cc2c1 |
| InChI | InChI=1S/C25H13F9O4S/c26-23(27,28)22(37,24(29,30)31)20-11-39-10-19(20)18-9-15(21(35)36)8-14-7-13(3-6-17(14)18)12-1-4-16(5-2-12)38-25(32,33)34/h1-11,37H,(H,35,36) |
| InChIKey | QFWPUZBCALDZQR-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.42 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |