About sodium 3-methylpentanoate
sodium 3-methylpentanoate (PubChem CID 54584941) has the molecular formula C6H11NaO2
and a molecular weight of 138.14 g/mol. Its IUPAC name is sodium 3-methylpentanoate.
Molecular Properties
| Compound Name | sodium 3-methylpentanoate |
| PubChem CID | 54584941 |
| Molecular Formula | C6H11NaO2 |
| Molecular Weight | 138.14 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | sodium 3-methylpentanoate |
| SMILES | CCC(C)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H12O2.Na/c1-3-5(2)4-6(7)8;/h5H,3-4H2,1-2H3,(H,7,8);/q;+1/p-1 |
| InChIKey | UONCLBUDXCZIOK-UHFFFAOYSA-M |
| XLogP | -2.82 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.14 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium 3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-methylpentanoate?
The IUPAC name of sodium 3-methylpentanoate (CID 54584941) is sodium 3-methylpentanoate.
What is the SMILES notation for sodium 3-methylpentanoate?
The canonical SMILES for sodium 3-methylpentanoate is CCC(C)CC(=O)[O-].[Na+].
What is the InChIKey of sodium 3-methylpentanoate?
The InChIKey is UONCLBUDXCZIOK-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O2.Na/c1-3-5(2)4-6(7)8;/h5H,3-4H2,1-2H3,(H,7,8);/q;+1/p-1.
What are the key properties of sodium 3-methylpentanoate?
sodium 3-methylpentanoate has a molecular weight of 138.14 g/mol, XLogP of -2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-methylpentanoate is sourced from PubChem (CID 54584941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).