sodium 3-methylpentanoate

C6H11NaO2 — CID 54584941

IUPACsodium 3-methylpentanoate
SMILESCCC(C)CC(=O)[O-].[Na+]
InChIInChI=1S/C6H12O2.Na/c1-3-5(2)4-6(7)8;/h5H,3-4H2,1-2H3,(H,7,8);/q;+1/p-1
InChIKeyUONCLBUDXCZIOK-UHFFFAOYSA-M
MW138.14 g/mol
LogP-2.82
Rot. Bonds3

About sodium 3-methylpentanoate

sodium 3-methylpentanoate (PubChem CID 54584941) has the molecular formula C6H11NaO2 and a molecular weight of 138.14 g/mol. Its IUPAC name is sodium 3-methylpentanoate.

Molecular Properties

Compound Namesodium 3-methylpentanoate
PubChem CID54584941
Molecular FormulaC6H11NaO2
Molecular Weight138.14 g/mol
Exact Mass138.07
IUPAC Namesodium 3-methylpentanoate
SMILESCCC(C)CC(=O)[O-].[Na+]
InChIInChI=1S/C6H12O2.Na/c1-3-5(2)4-6(7)8;/h5H,3-4H2,1-2H3,(H,7,8);/q;+1/p-1
InChIKeyUONCLBUDXCZIOK-UHFFFAOYSA-M
XLogP-2.82
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500138.14
LogP ≤ 5-2.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze sodium 3-methylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 3-methylpentanoate?
The IUPAC name of sodium 3-methylpentanoate (CID 54584941) is sodium 3-methylpentanoate.
What is the SMILES notation for sodium 3-methylpentanoate?
The canonical SMILES for sodium 3-methylpentanoate is CCC(C)CC(=O)[O-].[Na+].
What is the InChIKey of sodium 3-methylpentanoate?
The InChIKey is UONCLBUDXCZIOK-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O2.Na/c1-3-5(2)4-6(7)8;/h5H,3-4H2,1-2H3,(H,7,8);/q;+1/p-1.
What are the key properties of sodium 3-methylpentanoate?
sodium 3-methylpentanoate has a molecular weight of 138.14 g/mol, XLogP of -2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-methylpentanoate is sourced from PubChem (CID 54584941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).