C15H18BrClO — CID 5458495
(3S,5E,8E)-8-(1-bromopropylidene)-3-chloro-2-[(Z)-pent-2-en-4-ynyl]-2,3,4,7-tetrahydrooxocine (PubChem CID 5458495) has the molecular formula C15H18BrClO and a molecular weight of 329.67 g/mol. Its IUPAC name is (3S,5E,8E)-8-(1-bromopropylidene)-3-chloro-2-[(Z)-pent-2-en-4-ynyl]-2,3,4,7-tetrahydrooxocine.
| Compound Name | (3S,5E,8E)-8-(1-bromopropylidene)-3-chloro-2-[(Z)-pent-2-en-4-ynyl]-2,3,4,7-tetrahydrooxocine |
|---|---|
| PubChem CID | 5458495 |
| Molecular Formula | C15H18BrClO |
| Molecular Weight | 329.67 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | (3S,5E,8E)-8-(1-bromopropylidene)-3-chloro-2-[(Z)-pent-2-en-4-ynyl]-2,3,4,7-tetrahydrooxocine |
| SMILES | C#C/C=C\CC1O/C(=C(/Br)CC)C/C=C\C[C@@H]1Cl |
| InChI | InChI=1S/C15H18BrClO/c1-3-5-6-11-15-13(17)9-7-8-10-14(18-15)12(16)4-2/h1,5-8,13,15H,4,9-11H2,2H3/b6-5-,8-7-,14-12+/t13-,15?/m0/s1 |
| InChIKey | FMCNCJZDZVGTHG-WPROPPTGSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|