About bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate
bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate (PubChem CID 54585114) has the molecular formula C22H29N3O10
and a molecular weight of 495.49 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate.
Molecular Properties
| Compound Name | bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate |
| PubChem CID | 54585114 |
| Molecular Formula | C22H29N3O10 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate |
| SMILES | COC(=O)CC(C)N1CCN(c2ccccn2)CC1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C14H21N3O2.2C4H4O4/c1-12(11-14(18)19-2)16-7-9-17(10-8-16)13-5-3-4-6-15-13;2*5-3(6)1-2-4(7)8/h3-6,12H,7-11H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | PTJLUJOXDMAMBD-SPIKMXEPSA-N |
| XLogP | 0.58 |
| TPSA | 194.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate?
The IUPAC name of bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate (CID 54585114) is bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate.
What is the SMILES notation for bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate?
The canonical SMILES for bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate is COC(=O)CC(C)N1CCN(c2ccccn2)CC1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O.
What is the InChIKey of bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate?
The InChIKey is PTJLUJOXDMAMBD-SPIKMXEPSA-N. The full InChI is InChI=1S/C14H21N3O2.2C4H4O4/c1-12(11-14(18)19-2)16-7-9-17(10-8-16)13-5-3-4-6-15-13;2*5-3(6)1-2-4(7)8/h3-6,12H,7-11H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1-.
What are the key properties of bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate?
bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate has a molecular weight of 495.49 g/mol, XLogP of 0.58, 8 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis((Z)-but-2-enedioic acid);methyl 3-(4-pyridin-2-ylpiperazin-1-yl)butanoate is sourced from PubChem (CID 54585114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).